ChemNet > CAS > 459-47-2 1,4-ethylfluorobenzene
459-47-2 1,4-ethylfluorobenzene
상품명칭 |
1,4-ethylfluorobenzene |
별명 |
1-Ethyl-4-fluorobenzene; benzene, 1-ethyl-4-fluoro-; Ethyl-4-fluorobenzene |
분자식 |
C8H9F |
분자량 |
124.1555 |
InChI |
InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
cas번호 |
459-47-2 |
분자 구조 |
|
밀도 |
0.981g/cm3 |
비등점 |
141.6°C at 760 mmHg |
굴절 지수 |
1.477 |
인화점 |
28.9°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|