ChemNet > CAS > 459-59-6 4-Fluoro-N-methylaniline
459-59-6 4-Fluoro-N-methylaniline
| 상품명칭 |
4-Fluoro-N-methylaniline |
| 별명 |
4-Fluoro-N-toluidine |
| 분자식 |
C7H8FN |
| 분자량 |
125.1435 |
| InChI |
InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| cas번호 |
459-59-6 |
| EC번호 |
207-294-1 |
| 분자 구조 |
|
| 밀도 |
1.106g/cm3 |
| 비등점 |
181.4°C at 760 mmHg |
| 굴절 지수 |
1.546 |
| 인화점 |
63.5°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
