ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
상품명칭 |
2-aminothiophene-3-carbonitrile |
별명 |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
분자식 |
C5H4N2S |
분자량 |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
cas번호 |
4651-82-5 |
분자 구조 |
|
밀도 |
1.33g/cm3 |
녹는 점 |
104℃ |
비등점 |
317.5°C at 760 mmHg |
굴절 지수 |
1.627 |
인화점 |
145.8°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|