ChemNet > CAS > 4731-53-7 Tri-n-octylphosphine
4731-53-7 Tri-n-octylphosphine
| 상품명칭 |
Tri-n-octylphosphine |
| 별명 |
Phosphine, trioctyl-; Trioctylphosphine; trioctylphosphane; Trioctyl phosphine |
| 분자식 |
C24H51P |
| 분자량 |
370.6355 |
| InChI |
InChI=1/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| cas번호 |
4731-53-7 |
| EC번호 |
225-234-2 |
| 분자 구조 |
|
| 비등점 |
445°C at 760 mmHg |
| 인화점 |
236°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
