ChemNet > CAS > 4755-50-4 4-Dimethylaminobenzoylchloride
4755-50-4 4-Dimethylaminobenzoylchloride
| 상품명칭 |
4-Dimethylaminobenzoylchloride |
| 별명 |
4-Dimethylaminobenzoyl chloride; 4-(ethylamino)benzoyl chloride |
| 분자식 |
C9H10ClNO |
| 분자량 |
183.6348 |
| InChI |
InChI=1/C9H10ClNO/c1-11(2)8-5-3-7(4-6-8)9(10)12/h3-6H,1-2H3 |
| cas번호 |
4755-50-4 |
| 분자 구조 |
|
| 밀도 |
1.193g/cm3 |
| 비등점 |
279°C at 760 mmHg |
| 굴절 지수 |
1.574 |
| 인화점 |
122.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
