ChemNet > CAS > 4837-20-1 4-(difluoromethoxy)benzoic acid
4837-20-1 4-(difluoromethoxy)benzoic acid
상품명칭 |
4-(difluoromethoxy)benzoic acid |
별명 |
4-(difluoromethoxy)benzoate |
분자식 |
C8H5F2O3 |
분자량 |
187.1209 |
InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-3-1-5(2-4-6)7(11)12/h1-4,8H,(H,11,12)/p-1 |
cas번호 |
4837-20-1 |
분자 구조 |
|
녹는 점 |
169-171℃ |
비등점 |
272.1°C at 760 mmHg |
인화점 |
118.3°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|