ChemNet > CAS > 484-17-3 9-Phenanthrol
484-17-3 9-Phenanthrol
상품명칭 |
9-Phenanthrol |
별명 |
9-Hydroxyphenanthrene; phenanthren-9-ol |
분자식 |
C14H10O |
분자량 |
194.2286 |
InChI |
InChI=1/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
cas번호 |
484-17-3 |
EC번호 |
207-602-4 |
분자 구조 |
|
밀도 |
1.244g/cm3 |
녹는 점 |
139-143℃ |
비등점 |
404.5°C at 760 mmHg |
굴절 지수 |
1.753 |
인화점 |
197.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|