ChemNet > CAS > 4861-85-2 Isopropyl Phenylacetate
4861-85-2 Isopropyl Phenylacetate
| 상품명칭 |
Isopropyl Phenylacetate |
| 별명 |
1-Methylethyl benzeneacetate; Acetic acid, phenyl-, isopropyl ester; Benzeneacetic acid, 1-methylethyl ester; FEMA No. 2956; Isopropyl alpha-toluate; propan-2-yl phenylacetate |
| 분자식 |
C11H14O2 |
| 분자량 |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-9(2)13-11(12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| cas번호 |
4861-85-2 |
| EC번호 |
225-468-5 |
| 분자 구조 |
|
| 밀도 |
1.014g/cm3 |
| 비등점 |
237.7°C at 760 mmHg |
| 굴절 지수 |
1.497 |
| 인화점 |
97.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
