ChemNet > CAS > 488-23-3 1,2,3,4-Tetramethylbenzene
488-23-3 1,2,3,4-Tetramethylbenzene
상품명칭 |
1,2,3,4-Tetramethylbenzene |
별명 |
Prehenitene; 1,2,3,4-tetramethyl-benze |
분자식 |
C10H14 |
분자량 |
134.2182 |
InChI |
InChI=1/C10H14/c1-7-5-6-8(2)10(4)9(7)3/h5-6H,1-4H3 |
cas번호 |
488-23-3 |
EC번호 |
207-673-1 |
분자 구조 |
|
밀도 |
0.868g/cm3 |
비등점 |
204°C at 760 mmHg |
굴절 지수 |
1.501 |
인화점 |
69.7°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|