ChemNet > CAS > 4900-63-4 1-Methoxy-4-nitronaphthalene
4900-63-4 1-Methoxy-4-nitronaphthalene
상품명칭 |
1-Methoxy-4-nitronaphthalene |
별명 |
methyl 4-nitronaphthyl ether |
분자식 |
C11H9NO3 |
분자량 |
203.1941 |
InChI |
InChI=1/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
cas번호 |
4900-63-4 |
EC번호 |
225-528-0 |
분자 구조 |
|
밀도 |
1.274g/cm3 |
녹는 점 |
83-85℃ |
비등점 |
367.2°C at 760 mmHg |
굴절 지수 |
1.638 |
인화점 |
178.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|