ChemNet > CAS > 4906-24-5 3-Acetoxy-2-butanone
4906-24-5 3-Acetoxy-2-butanone
상품명칭 |
3-Acetoxy-2-butanone |
별명 |
Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone |
분자식 |
C6H10O3 |
분자량 |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
cas번호 |
4906-24-5 |
분자 구조 |
|
밀도 |
1.012g/cm3 |
비등점 |
163.4°C at 760 mmHg |
굴절 지수 |
1.406 |
인화점 |
56.6°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|