ChemNet > CAS > 495-71-6 1,2-Dibenzoylethane
495-71-6 1,2-Dibenzoylethane
상품명칭 |
1,2-Dibenzoylethane |
별명 |
1,2-Dibenzoylethane,(1,4-Diphenyl-1,4-butanedione); 1,4-Diphenyl-1,4-butanedione; 1,4-diphenylbutane-1,4-dione; 1,4-diphenyl-1,4-butadione |
분자식 |
C16H14O2 |
분자량 |
238.2812 |
InChI |
InChI=1/C16H14O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-10H,11-12H2 |
cas번호 |
495-71-6 |
분자 구조 |
|
밀도 |
1.116g/cm3 |
비등점 |
407.2°C at 760 mmHg |
굴절 지수 |
1.574 |
인화점 |
152.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|