ChemNet > CAS > 496-76-4 2,4,5-Trihydroxypyrimidine
496-76-4 2,4,5-Trihydroxypyrimidine
상품명칭 |
2,4,5-Trihydroxypyrimidine |
별명 |
Isobarbituric acid; 5-hydroxypyrimidine-2,4(1H,3H)-dione; dihydropyrimidine-2,4,5(3H)-trione |
분자식 |
C4H4N2O3 |
분자량 |
128.0862 |
InChI |
InChI=1/C4H4N2O3/c7-2-1-5-4(9)6-3(2)8/h1H2,(H2,5,6,8,9) |
cas번호 |
496-76-4 |
EC번호 |
207-829-9 |
분자 구조 |
|
밀도 |
1.455g/cm3 |
녹는 점 |
300℃ |
굴절 지수 |
1.492 |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|