ChemNet > CAS > 4964-71-0 5-Bromo-quinoline
4964-71-0 5-Bromo-quinoline
| 상품명칭 |
5-Bromo-quinoline |
| 별명 |
5-Bromoquinoline; RARECHEM AK ML 0010; 5-Bromoquinoline,97% |
| 분자식 |
C9H6BrN |
| 분자량 |
208.0546 |
| InChI |
InChI=1/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
| cas번호 |
4964-71-0 |
| 분자 구조 |
|
| 밀도 |
1.564g/cm3 |
| 비등점 |
295.9°C at 760 mmHg |
| 굴절 지수 |
1.673 |
| 인화점 |
132.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
