ChemNet > CAS > 4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
상품명칭 |
4-Hydroxy-6-methyl-3-nitro-2-pyridone |
별명 |
2-hydroxy-6-methyl-3-nitropyridin-4(1H)-one |
분자식 |
C6H6N2O4 |
분자량 |
170.1228 |
InChI |
InChI=1/C6H6N2O4/c1-3-2-4(9)5(8(11)12)6(10)7-3/h2H,1H3,(H2,7,9,10) |
cas번호 |
4966-90-9 |
분자 구조 |
|
밀도 |
1.53g/cm3 |
녹는 점 |
293-296℃ |
비등점 |
265.6°C at 760 mmHg |
굴절 지수 |
1.608 |
인화점 |
114.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|