ChemNet > CAS > 499770-76-2 5-(Bromomethyl)-1-methyl-1H-1,2,3-benzotriazole
499770-76-2 5-(Bromomethyl)-1-methyl-1H-1,2,3-benzotriazole
| 상품명칭 |
5-(Bromomethyl)-1-methyl-1H-1,2,3-benzotriazole |
| 별명 |
5-(bromomethyl)-1-methyl-1H-benzo[d][1,2,3]triazole; 5-(Bromomethyl)-1-methyl-1H-benzotriazole; 5-(bromomethyl)-1-methyl-benzotriazole |
| 분자식 |
C8H8BrN3 |
| 분자량 |
226.0732 |
| InChI |
InChI=1/C8H8BrN3/c1-12-8-3-2-6(5-9)4-7(8)10-11-12/h2-4H,5H2,1H3 |
| cas번호 |
499770-76-2 |
| 분자 구조 |
|
| 밀도 |
1.66g/cm3 |
| 녹는 점 |
115℃ |
| 비등점 |
355.735°C at 760 mmHg |
| 굴절 지수 |
1.685 |
| 인화점 |
168.943°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
