ChemNet > CAS > 501-24-6 3-n-Pentadecylphenol
501-24-6 3-n-Pentadecylphenol
| 상품명칭 |
3-n-Pentadecylphenol |
| 별명 |
Pentadecylphenol; 3-pentadecylphenol; 3-Pentadecyl phenol |
| 분자식 |
C21H36O |
| 분자량 |
304.5099 |
| InChI |
InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
| cas번호 |
501-24-6 |
| EC번호 |
207-921-9 |
| 분자 구조 |
|
| 밀도 |
0.908g/cm3 |
| 녹는 점 |
47-53℃ |
| 비등점 |
402°C at 760 mmHg |
| 굴절 지수 |
1.495 |
| 인화점 |
246.3°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
