ChemNet > CAS > 50998-17-9 6-bromoquinoxaline
50998-17-9 6-bromoquinoxaline
상품명칭 |
6-bromoquinoxaline |
별명 |
Quinoxaline, 6-bromo- |
분자식 |
C8H5BrN2 |
분자량 |
209.0427 |
InChI |
InChI=1/C8H5BrN2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-5H |
cas번호 |
50998-17-9 |
분자 구조 |
|
밀도 |
1.656g/cm3 |
녹는 점 |
53℃ |
비등점 |
300.2°C at 760 mmHg |
굴절 지수 |
1.685 |
인화점 |
135.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|