ChemNet > CAS > 5102-79-4 2-Diphenylacetyl-1,3-indandione-1-hydrazone
5102-79-4 2-Diphenylacetyl-1,3-indandione-1-hydrazone
상품명칭 |
2-Diphenylacetyl-1,3-indandione-1-hydrazone |
별명 |
Difezon; NSC 83445; 1,3-Indandione, 2-(diphenylacetyl)-, 1-hydrazone (8CI); 1H-Indene-1,3(2H)-dione, 2-(diphenylacetyl)-, 1-hydrazone (9CI); 2-(Diphenylacetyl)-1H-indene-1,3(2H)-dione 1-hydrazone; 2-(diphenylacetyl)-3-hydrazinylidene-2,3-dihydro-1H-inden-1-one; (3Z)-2-(diphenylacetyl)-3-hydrazono-2,3-dihydro-1H-inden-1-one; 2-(diphenylacetyl)-3-hydrazino-1H-inden-1-one |
분자식 |
C23H18N2O2 |
분자량 |
354.4012 |
InChI |
InChI=1/C23H18N2O2/c24-25-21-17-13-7-8-14-18(17)22(26)20(21)23(27)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19,25H,24H2 |
cas번호 |
5102-79-4 |
EC번호 |
225-821-3 |
분자 구조 |
|
밀도 |
1.3g/cm3 |
녹는 점 |
241-243℃ |
비등점 |
593.6°C at 760 mmHg |
굴절 지수 |
1.695 |
인화점 |
312.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|