ChemNet > CAS > 5147-80-8 2-(bis(methylthio)methylene)malononitrile
5147-80-8 2-(bis(methylthio)methylene)malononitrile
| 상품명칭 |
2-(bis(methylthio)methylene)malononitrile |
| 별명 |
2-[Di(methylthio)methylidene]malononitrile; [bis(methylsulfanyl)methylidene]propanedinitrile |
| 분자식 |
C6H6N2S2 |
| 분자량 |
170.2552 |
| InChI |
InChI=1/C6H6N2S2/c1-9-6(10-2)5(3-7)4-8/h1-2H3 |
| cas번호 |
5147-80-8 |
| 분자 구조 |
|
| 밀도 |
1.256g/cm3 |
| 녹는 점 |
76℃ |
| 비등점 |
248.3°C at 760 mmHg |
| 굴절 지수 |
1.584 |
| 인화점 |
103.9°C |
| 위험성 표시 |
 T:Toxic;
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
