ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
상품명칭 |
4-Iodophenylacetonitrile |
별명 |
4-Iodobenzyl cyanide |
분자식 |
C8H6IN |
분자량 |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
cas번호 |
51628-12-7 |
분자 구조 |
|
밀도 |
1.764g/cm3 |
비등점 |
285.8°C at 760 mmHg |
굴절 지수 |
1.624 |
인화점 |
126.6°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|