ChemNet > CAS > 51660-08-3 5-chloro-6-phenylpyridazin-3-ol
51660-08-3 5-chloro-6-phenylpyridazin-3-ol
상품명칭 |
5-chloro-6-phenylpyridazin-3-ol |
별명 |
5-chloro-2-methyl-6-phenylpyridazin-3(2H)-one; 5-chloro-6-phenylpyridazin-3(2H)-one |
분자식 |
C10H7ClN2O |
분자량 |
206.6284 |
InChI |
InChI=1/C10H7ClN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
cas번호 |
51660-08-3 |
분자 구조 |
|
밀도 |
1.35g/cm3 |
녹는 점 |
235℃ |
비등점 |
403.2°C at 760 mmHg |
굴절 지수 |
1.641 |
인화점 |
197.7°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|