ChemNet > CAS > 51707-38-1 3,4-Dimethoxybenzhydrazide
51707-38-1 3,4-Dimethoxybenzhydrazide
상품명칭 |
3,4-Dimethoxybenzhydrazide |
별명 |
3,5-dimethoxybenzohydrazide; 3,5-Dimethoxybenzhydrazide |
분자식 |
C9H12N2O3 |
분자량 |
196.2032 |
InChI |
InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
cas번호 |
51707-38-1 |
분자 구조 |
|
밀도 |
1.189g/cm3 |
녹는 점 |
143-144℃ |
굴절 지수 |
1.544 |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|