ChemNet > CAS > 5228-49-9 1-Methyl-5-nitroindazole
5228-49-9 1-Methyl-5-nitroindazole
상품명칭 |
1-Methyl-5-nitroindazole |
별명 |
1-methyl-5-nitro-1H-indazole |
분자식 |
C8H7N3O2 |
분자량 |
177.1601 |
InChI |
InChI=1/C8H7N3O2/c1-10-8-3-2-7(11(12)13)4-6(8)5-9-10/h2-5H,1H3 |
cas번호 |
5228-49-9 |
분자 구조 |
|
밀도 |
1.425g/cm3 |
비등점 |
332.863°C at 760 mmHg |
굴절 지수 |
1.677 |
인화점 |
155.11°C |
위험성 표시 |
|
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|