ChemNet > CAS > 52287-51-1 3,4-Ethylenedioxybromobenzene
52287-51-1 3,4-Ethylenedioxybromobenzene
상품명칭 |
3,4-Ethylenedioxybromobenzene |
별명 |
3,4-(Ethylenedioxy)bromobenzene; 6-Bromo-1,4-benzodioxane; 6-Bromo-2,3-dihydro-1,4-benzodioxine |
분자식 |
C8H7BrO2 |
분자량 |
215.044 |
InChI |
InChI=1/C8H7BrO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4H2 |
cas번호 |
52287-51-1 |
EC번호 |
257-817-2 |
분자 구조 |
|
밀도 |
1.598g/cm3 |
비등점 |
258.299°C at 760 mmHg |
굴절 지수 |
1.579 |
인화점 |
117.638°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|