ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
| 상품명칭 |
2,5-Dibromo-3,4-dinitrothiophene |
| 별명 |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
| 분자식 |
C4Br2N2O4S |
| 분자량 |
331.9268 |
| InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
| cas번호 |
52431-30-8 |
| 분자 구조 |
|
| 밀도 |
2.459g/cm3 |
| 비등점 |
341.2°C at 760 mmHg |
| 굴절 지수 |
1.716 |
| 인화점 |
160.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
