ChemNet > CAS > 527-31-1 Hexaketocyclohexane octahydrate
527-31-1 Hexaketocyclohexane octahydrate
| 상품명칭 |
Hexaketocyclohexane octahydrate |
| 별명 |
cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
| 분자식 |
C6H16O14 |
| 분자량 |
312.1828 |
| InChI |
InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
| cas번호 |
527-31-1 |
| EC번호 |
208-412-4 |
| 분자 구조 |
|
| 녹는 점 |
90-93℃ |
| 비등점 |
344.7°C at 760 mmHg |
| 인화점 |
152°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
