ChemNet > CAS > 527-52-6 D(+)-Digitoxose
527-52-6 D(+)-Digitoxose
상품명칭 |
D(+)-Digitoxose |
별명 |
2,6-Dideoxy-D-ribohexose; Digitoxose; 2,6-dideoxy-D-ribo-hexopyranose; 2,6-dideoxy-alpha-D-ribo-hexopyranose; 2,6-dideoxy-beta-D-ribo-hexopyranose |
분자식 |
C6H12O4 |
분자량 |
148.1571 |
InChI |
InChI=1/C6H12O4/c1-3-6(9)4(7)2-5(8)10-3/h3-9H,2H2,1H3/t3-,4+,5-,6-/m1/s1 |
cas번호 |
527-52-6 |
EC번호 |
208-416-6 |
분자 구조 |
|
밀도 |
1.366g/cm3 |
녹는 점 |
112-100℃ |
비등점 |
320.1°C at 760 mmHg |
굴절 지수 |
1.542 |
인화점 |
147.4°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|