ChemNet > CAS > 52708-32-4 4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline
52708-32-4 4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline
상품명칭 |
4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline |
분자식 |
C11H13N3 |
분자량 |
187.241 |
InChI |
InChI=1/C11H13N3/c1-8-7-9(2)14(13-8)11-5-3-10(12)4-6-11/h3-7H,12H2,1-2H3 |
cas번호 |
52708-32-4 |
분자 구조 |
|
밀도 |
1.14g/cm3 |
녹는 점 |
78℃ |
비등점 |
338.2°C at 760 mmHg |
굴절 지수 |
1.611 |
인화점 |
158.3°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|