ChemNet > CAS > 529-84-0 4-Methylesculetin
529-84-0 4-Methylesculetin
상품명칭 |
4-Methylesculetin |
별명 |
6,7-Dihydroxy-4-methylcoumarin; 4-Methylesculetin, (6,7-Dihydroxy-4-methylcoumarin); 4-methylaesculetin; 6,7-dihydroxy-4-methyl-2H-chromen-2-one |
분자식 |
C10H8O4 |
분자량 |
192.1681 |
InChI |
InChI=1/C10H8O4/c1-5-2-10(13)14-9-4-8(12)7(11)3-6(5)9/h2-4,11-12H,1H3 |
cas번호 |
529-84-0 |
EC번호 |
208-470-0 |
분자 구조 |
|
밀도 |
1.456g/cm3 |
녹는 점 |
274-276℃ |
비등점 |
455.5°C at 760 mmHg |
굴절 지수 |
1.651 |
인화점 |
190.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|