ChemNet > CAS > 5306-96-7 2,3-Dimethyl-p-phenylenediamine
5306-96-7 2,3-Dimethyl-p-phenylenediamine
| 상품명칭 |
2,3-Dimethyl-p-phenylenediamine |
| 별명 |
p-Phenylenediamine, 2,3-dimethyl-; 4-Amino-5,6-dimethylaniline; CCRIS 8132; 2,3-dimethylbenzene-1,4-diamine; 1,4-Diamino-2,3-dimethylbenzene |
| 분자식 |
C8H12N2 |
| 분자량 |
136.1943 |
| InChI |
InChI=1/C8H12N2/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,9-10H2,1-2H3 |
| cas번호 |
5306-96-7 |
| 분자 구조 |
|
| 밀도 |
1.076g/cm3 |
| 비등점 |
288.5°C at 760 mmHg |
| 굴절 지수 |
1.618 |
| 인화점 |
151.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
