ChemNet > CAS > 53233-89-9 5-Chloro-2,3-dihydroxypyridine
53233-89-9 5-Chloro-2,3-dihydroxypyridine
상품명칭 |
5-Chloro-2,3-dihydroxypyridine |
별명 |
5-Chloropyridine-2,3-diol; 5-chloro-3-hydroxypyridin-2(1H)-one |
분자식 |
C5H4ClNO2 |
분자량 |
145.5438 |
InChI |
InChI=1/C5H4ClNO2/c6-3-1-4(8)5(9)7-2-3/h1-2,8H,(H,7,9) |
cas번호 |
53233-89-9 |
EC번호 |
258-441-1 |
분자 구조 |
|
밀도 |
1.56g/cm3 |
녹는 점 |
295℃ |
비등점 |
297.6°C at 760 mmHg |
굴절 지수 |
1.617 |
인화점 |
133.8°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|