ChemNet > CAS > 535-32-0 D-Ethionine
535-32-0 D-Ethionine
| 상품명칭 |
D-Ethionine |
| 별명 |
D-2-Amino-4-(ethylthio)butyric acid; S-ethyl-D-homocysteine |
| 분자식 |
C6H13NO2S |
| 분자량 |
163.2379 |
| InChI |
InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
| cas번호 |
535-32-0 |
| EC번호 |
208-612-1 |
| 분자 구조 |
|
| 밀도 |
1.164g/cm3 |
| 녹는 점 |
278℃ |
| 비등점 |
310.4°C at 760 mmHg |
| 굴절 지수 |
1.523 |
| 인화점 |
141.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
