ChemNet > CAS > 537-47-3 4-Phenylsemicarbazide
537-47-3 4-Phenylsemicarbazide
상품명칭 |
4-Phenylsemicarbazide |
별명 |
Phenylsemicarbazide |
분자식 |
C7H9N3O |
분자량 |
151.16
|
InChI |
InChI=1/C7H9N3O/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11) |
cas번호 |
537-47-3 |
EC번호 |
208-669-2 |
분자 구조 |
|
녹는 점 |
122-127℃ |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|