ChemNet > CAS > 538-58-9;35225-79-7 Dibenzylideneacetone
538-58-9;35225-79-7 Dibenzylideneacetone
| 상품명칭 |
Dibenzylideneacetone |
| 별명 |
1,5-Diphenyl-1,4-pentadien-3-one; distyryl ketone; trans,trans-Dibenzylideneacetone; Dibenzylidene acetone; 1,5-diphenylpenta-1,4-dien-3-one; (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one; (1Z,4Z)-1,5-diphenylpenta-1,4-dien-3-one; (1E)-1,5-diphenylpenta-1,4-dien-3-one; 1,5-Diphenyl-3-pentadienone |
| 분자식 |
C17H14O |
| 분자량 |
234.2925 |
| InChI |
InChI=1/C17H14O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14H/b13-11+,14-12u |
| cas번호 |
538-58-9;35225-79-7 |
| EC번호 |
208-697-5 |
| 분자 구조 |
|
| 밀도 |
1.1g/cm3 |
| 녹는 점 |
112-114℃ |
| 비등점 |
400.7°C at 760 mmHg |
| 굴절 지수 |
1.649 |
| 인화점 |
176.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
