ChemNet > CAS > 538-65-8 butyl cinnamate
538-65-8 butyl cinnamate
| 상품명칭 |
butyl cinnamate |
| 별명 |
n-Butyl cinnamate, (Cinnamic acid n-butyl ester); Cinnamic acid n-butyl ester; n-Butyl cinnamate; butyl 3-phenylprop-2-enoate; butyl (2E)-3-phenylprop-2-enoate |
| 분자식 |
C13H16O2 |
| 분자량 |
204.2649 |
| InChI |
InChI=1/C13H16O2/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12/h4-10H,2-3,11H2,1H3/b10-9+ |
| cas번호 |
538-65-8 |
| EC번호 |
208-699-6 |
| 분자 구조 |
|
| 밀도 |
1.021g/cm3 |
| 비등점 |
302.7°C at 760 mmHg |
| 굴절 지수 |
1.537 |
| 인화점 |
163.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
