ChemNet > CAS > 53894-23-8 triisononyl trimellitate, mixture of isomers
53894-23-8 triisononyl trimellitate, mixture of isomers
상품명칭 |
triisononyl trimellitate, mixture of isomers |
별명 |
Triisononyl trimellitate; tris(7-methyloctyl) benzene-1,2,4-tricarboxylate; TINIM |
분자식 |
C36H60O6 |
분자량 |
588.858 |
InChI |
InChI=1/C36H60O6/c1-28(2)19-13-7-10-16-24-40-34(37)31-22-23-32(35(38)41-25-17-11-8-14-20-29(3)4)33(27-31)36(39)42-26-18-12-9-15-21-30(5)6/h22-23,27-30H,7-21,24-26H2,1-6H3 |
cas번호 |
53894-23-8 |
EC번호 |
258-847-9 |
분자 구조 |
|
밀도 |
0.98g/cm3 |
비등점 |
617.6°C at 760 mmHg |
굴절 지수 |
1.486 |
인화점 |
248.6°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|