ChemNet > CAS > 539-44-6 p-tolylhydrazine
539-44-6 p-tolylhydrazine
| 상품명칭 |
p-tolylhydrazine |
| 별명 |
4-Methylphenylhydrazine; (4-methylphenyl)hydrazine hydrochloride (1:1) |
| 분자식 |
C7H11ClN2 |
| 분자량 |
158.6286 |
| InChI |
InChI=1/C7H10N2.ClH/c1-6-2-4-7(9-8)5-3-6;/h2-5,9H,8H2,1H3;1H |
| cas번호 |
539-44-6 |
| EC번호 |
208-717-2 |
| 분자 구조 |
|
| 비등점 |
242.8°C at 760 mmHg |
| 인화점 |
115.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
