ChemNet > CAS > 5391-30-0 2-Bromophenylthiourea
5391-30-0 2-Bromophenylthiourea
상품명칭 |
2-Bromophenylthiourea |
별명 |
Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
분자식 |
C7H7BrN2S |
분자량 |
231.1129 |
InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
cas번호 |
5391-30-0 |
분자 구조 |
|
밀도 |
1.728g/cm3 |
비등점 |
314.2°C at 760 mmHg |
굴절 지수 |
1.748 |
인화점 |
143.8°C |
위험성 표시 |
|
리스크 규칙 |
R25:Toxic if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|