ChemNet > CAS > 5425-44-5 2-phenyl-1,3-dithiane
5425-44-5 2-phenyl-1,3-dithiane
상품명칭 |
2-phenyl-1,3-dithiane |
별명 |
m-Dithiane, 2-phenyl-; 1,3-Dithiane, 2-phenyl-; 2-Phenyl-1,3-dithiane; 2-Phenyl-m-dithiane; 5-19-01-00462 (Beilstein Handbook Reference); BRN 0130879; NSC 12763; 1,3-Dithiane, 2-phenyl- (9CI) |
분자식 |
C10H12S2 |
분자량 |
196.3323 |
InChI |
InChI=1/C10H12S2/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-3,5-6,10H,4,7-8H2 |
cas번호 |
5425-44-5 |
EC번호 |
226-568-1 |
분자 구조 |
|
밀도 |
1.157g/cm3 |
비등점 |
326.8°C at 760 mmHg |
굴절 지수 |
1.615 |
인화점 |
158.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|