ChemNet > CAS > 552-22-7 thymol iodide
552-22-7 thymol iodide
상품명칭 |
thymol iodide |
별명 |
5,5-diisopropyl-2,2-dimethylbiphenyl-4,4-diyl dihypoiodite; Dithymol diiodide; 2,2'-dimethyl-5,5'-di(propan-2-yl)biphenyl-4,4'-diyl dihypoiodite |
분자식 |
C20H24I2O2 |
분자량 |
550.2123 |
InChI |
InChI=1/C20H24I2O2/c1-11(2)15-9-17(13(5)7-19(15)23-21)18-10-16(12(3)4)20(24-22)8-14(18)6/h7-12H,1-6H3 |
cas번호 |
552-22-7 |
EC번호 |
209-007-5 |
분자 구조 |
|
밀도 |
1.617g/cm3 |
비등점 |
479°C at 760 mmHg |
굴절 지수 |
1.616 |
인화점 |
243.5°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|