ChemNet > CAS > 555-90-8 Nicothiazone
555-90-8 Nicothiazone
| 상품명칭 |
Nicothiazone |
| 별명 |
3-Formylpyridine thiosemicarbazone; Nicotinaldehyde, thiocarbohydrazone; Nicotinaldehyde thiosemicarbazone; Pyridine-3-carboxaldehyde, thiosemicarbazone; ; 2-(pyridin-3-ylmethylidene)hydrazinecarbothioamide; pyridine-3-carbaldehyde thiosemicarbazone; Pyridine-3-aldehyde thiosemicarbazone |
| 분자식 |
C7H8N4S |
| 분자량 |
180.2302 |
| InChI |
InChI=1/C7H8N4S/c8-7(12)11-10-5-6-2-1-3-9-4-6/h1-5H,(H3,8,11,12)/b10-5+ |
| cas번호 |
555-90-8 |
| EC번호 |
209-108-4 |
| 분자 구조 |
|
| 밀도 |
1.32g/cm3 |
| 비등점 |
346.5°C at 760 mmHg |
| 굴절 지수 |
1.665 |
| 인화점 |
163.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R25:Toxic if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
