ChemNet > CAS > 556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
상품명칭 |
1,4-Cyclohexanediol, mixture of cis and trans |
별명 |
Cyclohexanediolcistrans; 1,4-Cyclohexanediol; Hexahydrohydroquinone; 1,4-Hexandiol; Quinitol; 1,4-Bis(hydroxymethyl)-cyclohexane; cyclohexane-1,4-diol; trans-cyclohexane-1,4-diol; 1,4-Cyclohexanediol (cis & trans mixture) |
분자식 |
C6H12O2 |
분자량 |
116.1583 |
InChI |
InChI=1/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- |
cas번호 |
556-48-9 |
EC번호 |
209-126-2 |
분자 구조 |
|
밀도 |
1.156g/cm3 |
녹는 점 |
98-100℃ |
비등점 |
252.4°C at 760 mmHg |
굴절 지수 |
1.526 |
인화점 |
65.6°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:;
|
|