ChemNet > CAS > 55751-54-7 2-sec-butylaniline
55751-54-7 2-sec-butylaniline
상품명칭 |
2-sec-butylaniline |
별명 |
Benzenamine, 2-(1-methylpropyl)-; 2-sec-Butylaniline; 2-(butan-2-yl)aniline |
분자식 |
C10H15N |
분자량 |
149.2328 |
InChI |
InChI=1/C10H15N/c1-3-8(2)9-6-4-5-7-10(9)11/h4-8H,3,11H2,1-2H3 |
cas번호 |
55751-54-7 |
EC번호 |
259-794-4 |
분자 구조 |
|
밀도 |
0.942g/cm3 |
비등점 |
239°C at 760 mmHg |
굴절 지수 |
1.535 |
인화점 |
101.5°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|