ChemNet > CAS > 5660-91-3 Phencyclone
5660-91-3 Phencyclone
상품명칭 |
Phencyclone |
별명 |
1,3-Diphenyl-2H-cyclopenta(l)phenanthren-2-one; 1,3-Diphenyl-2H-cyclopenta[l]phenanthren-2-one; 2H-cyclopenta[l]phenanthren-2-one, 1,3-diphenyl- |
분자식 |
C29H18O |
분자량 |
382.4526 |
InChI |
InChI=1/C29H18O/c30-29-25(19-11-3-1-4-12-19)27-23-17-9-7-15-21(23)22-16-8-10-18-24(22)28(27)26(29)20-13-5-2-6-14-20/h1-18H |
cas번호 |
5660-91-3 |
EC번호 |
227-112-4 |
분자 구조 |
|
밀도 |
1.29g/cm3 |
비등점 |
673.6°C at 760 mmHg |
굴절 지수 |
1.739 |
인화점 |
294.9°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|