ChemNet > CAS > 576-82-9 5-Fluoro-1,2,3-tribromobenzene
576-82-9 5-Fluoro-1,2,3-tribromobenzene
상품명칭 |
5-Fluoro-1,2,3-tribromobenzene |
별명 |
1,2,3-Tribromo-5-fluorobenzene |
분자식 |
C6H2Br3F |
분자량 |
332.7905 |
InChI |
InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
cas번호 |
576-82-9 |
분자 구조 |
|
밀도 |
2.34g/cm3 |
비등점 |
274.2°C at 760 mmHg |
굴절 지수 |
1.61 |
인화점 |
119.6°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|