ChemNet > CAS > 58161-35-6 N1-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide
58161-35-6 N1-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide
상품명칭 |
N1-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide |
별명 |
5-(Acetylamino)-1-indanone; 5-Acetamido-1-indanone; 5-Acetylamino-1-indanone; N-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide |
분자식 |
C11H11NO2 |
분자량 |
189.2105 |
InChI |
InChI=1/C11H11NO2/c1-7(13)12-9-3-4-10-8(6-9)2-5-11(10)14/h3-4,6H,2,5H2,1H3,(H,12,13) |
cas번호 |
58161-35-6 |
분자 구조 |
|
밀도 |
1.278g/cm3 |
녹는 점 |
169℃ |
비등점 |
427.362°C at 760 mmHg |
굴절 지수 |
1.632 |
인화점 |
194.835°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|