ChemNet > CAS > 583-03-9 Fenipentol
583-03-9 Fenipentol
상품명칭 |
Fenipentol |
별명 |
.alpha.-Butylbenzenemethanol; .alpha.-Butylbenzyl alcohol; 1-Phenylpentan-1-ol; 583-03-9; a-Butylbenzyl Alcohol; Benzenemethanol, .alpha.-butyl-; benzenemethanol, alpha-butyl-; Benzyl alcohol, .alpha.-butyl-; Butyl hydroxy toluene |
분자식 |
C11H16O |
분자량 |
164.2441 |
InChI |
InChI=1/C11H16O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,2-3,9H2,1H3 |
cas번호 |
583-03-9 |
EC번호 |
209-493-9 |
분자 구조 |
|
밀도 |
0.965g/cm3 |
비등점 |
245.2°C at 760 mmHg |
굴절 지수 |
1.514 |
인화점 |
110.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|