ChemNet > CAS > 589-17-3 4-Bromobenzyl chloride
589-17-3 4-Bromobenzyl chloride
| 상품명칭 |
4-Bromobenzyl chloride |
| 별명 |
4-Bromo-alpha-chlorotoluene; 1-Bromo-4-(chloromethyl)-benzene; p-Bromobenzyl chloride |
| 분자식 |
C7H6BrCl |
| 분자량 |
205.4795 |
| InChI |
InChI=1/C7H6BrCl/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2 |
| cas번호 |
589-17-3 |
| EC번호 |
209-638-6 |
| 분자 구조 |
|
| 밀도 |
1.541g/cm3 |
| 녹는 점 |
36-40℃ |
| 비등점 |
236°C at 760 mmHg |
| 굴절 지수 |
1.569 |
| 인화점 |
111.7°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| 보안 규칙 |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
