ChemNet > CAS > 589-62-8 4-octanol
589-62-8 4-octanol
상품명칭 |
4-octanol |
별명 |
n-Butyl n-propyl carbinol; octan-4-ol |
분자식 |
C8H18O |
분자량 |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
cas번호 |
589-62-8 |
EC번호 |
209-654-3 |
분자 구조 |
|
밀도 |
0.821g/cm3 |
비등점 |
179.2°C at 760 mmHg |
굴절 지수 |
1.426 |
인화점 |
71.1°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|